CAS 325855-09-2 appears in our catalog under these names: 4-(4-(Morpholine-4-sulfonyl)-2-nitrophenyl)morpholine, 4-(4-(Morpholine-4-sulfonyl)-2-nitrophenyl)morpholine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)morpholine (CAS 325855-09-2) is a chemical compound with the molecular formula C14H19N3O6S and a molecular weight of 357.38 g/mol. IUPAC name: 4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)morpholine. InChIKey: ZUSHGIMCLKVKEA-UHFFFAOYSA-N.
| Molecular formula | C14H19N3O6S |
|---|---|
| Molecular weight | 357.38 g/mol |
| IUPAC name | 4-(4-morpholin-4-ylsulfonyl-2-nitrophenyl)morpholine |
| InChIKey | ZUSHGIMCLKVKEA-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)S(=O)(=O)N3CCOCC3)[N+](=O)[O-] |
Computed by PubChem (NCBI)