Products 1313529-41-7
CAS 1313529-41-7 is the registry number for 5-Mercapto-N6-(((4-nitrophenyl)methoxy)carbonyl)lysine. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-amino-6-[(4-nitrophenyl)methoxycarbonylamino]-5-sulfanylhexanoic acid (CAS 1313529-41-7) is a chemical compound with the molecular formula C14H19N3O6S and a molecular weight of 357.38 g/mol. IUPAC name: (2S)-2-amino-6-[(4-nitrophenyl)methoxycarbonylamino]-5-sulfanylhexanoic acid. InChIKey: GXQSENXBLQAQSW-KIYNQFGBSA-N.
| Molecular formula | C14H19N3O6S |
|---|---|
| Molecular weight | 357.38 g/mol |
| IUPAC name | (2S)-2-amino-6-[(4-nitrophenyl)methoxycarbonylamino]-5-sulfanylhexanoic acid |
| InChIKey | GXQSENXBLQAQSW-KIYNQFGBSA-N |
| SMILES | C1=CC(=CC=C1COC(=O)NCC(CC[C@@H](C(=O)O)N)S)[N+](=O)[O-] |
Computed by PubChem (NCBI)