Products 2138110-23-1
CAS 2138110-23-1 is the registry number for 11-​(Iodomethyl)​- 10-​oxadispiro(3.0.3.3)​undecan-​9-​one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
11-(iodomethyl)-10-oxadispiro[3.0.35.34]undecan-9-one (CAS 2138110-23-1) is a chemical compound with the molecular formula C11H15IO2 and a molecular weight of 306.14 g/mol. IUPAC name: 11-(iodomethyl)-10-oxadispiro[3.0.35.34]undecan-9-one. InChIKey: DKHBCQOIMGHLEM-UHFFFAOYSA-N.
| Molecular formula | C11H15IO2 |
|---|---|
| Molecular weight | 306.14 g/mol |
| IUPAC name | 11-(iodomethyl)-10-oxadispiro[3.0.35.34]undecan-9-one |
| InChIKey | DKHBCQOIMGHLEM-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C(OC(=O)C23CCC3)CI |
Computed by PubChem (NCBI)