Products 42711-77-3
CAS 42711-77-3 is the registry number for 3-Iodoadamantane-1-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-iodoadamantane-1-carboxylic acid (CAS 42711-77-3) is a chemical compound with the molecular formula C11H15IO2 and a molecular weight of 306.14 g/mol. IUPAC name: 3-iodoadamantane-1-carboxylic acid. InChIKey: VMCNPOBDWYHJAP-UHFFFAOYSA-N.
| Molecular formula | C11H15IO2 |
|---|---|
| Molecular weight | 306.14 g/mol |
| IUPAC name | 3-iodoadamantane-1-carboxylic acid |
| InChIKey | VMCNPOBDWYHJAP-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)I)C(=O)O |
Computed by PubChem (NCBI)