Products 2138130-01-3
CAS 2138130-01-3 is the registry number for 3-(3,3-Dimethylcyclohexyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3,3-dimethylcyclohexyl)aniline;hydrochloride (CAS 2138130-01-3) is a chemical compound with the molecular formula C14H22ClN and a molecular weight of 239.78 g/mol. IUPAC name: 3-(3,3-dimethylcyclohexyl)aniline;hydrochloride. InChIKey: UKCBACSNGOUBMI-UHFFFAOYSA-N.
| Molecular formula | C14H22ClN |
|---|---|
| Molecular weight | 239.78 g/mol |
| IUPAC name | 3-(3,3-dimethylcyclohexyl)aniline;hydrochloride |
| InChIKey | UKCBACSNGOUBMI-UHFFFAOYSA-N |
| SMILES | CC1(CCCC(C1)C2=CC(=CC=C2)N)C.Cl |
Computed by PubChem (NCBI)