CAS 213814-61-0 appears in our catalog under these names: N-Benzyl-3-bromoaniline, 98%, N–Benzyl–3–bromoaniline, N-benzyl-3-bromoaniline, N-Benzyl-3-bromoaniline, >97%, >97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 100g, 25g, 1g, 2,5g, 100mg, 250mg.
N-benzyl-3-bromoaniline (CAS 213814-61-0) is a chemical compound with the molecular formula C13H12BrN and a molecular weight of 262.14 g/mol. IUPAC name: N-benzyl-3-bromoaniline. InChIKey: NUZUUCXESJBUMX-UHFFFAOYSA-N.
| Molecular formula | C13H12BrN |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | N-benzyl-3-bromoaniline |
| InChIKey | NUZUUCXESJBUMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)