CAS 220441-82-7 appears in our catalog under these names: (S)-(4-Bromophenyl)(phenyl)methanamine, 95%, (S)–(4–Bromophenyl)(phenyl)methanamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(S)-(4-bromophenyl)-phenylmethanamine (CAS 220441-82-7) is a chemical compound with the molecular formula C13H12BrN and a molecular weight of 262.14 g/mol. IUPAC name: (S)-(4-bromophenyl)-phenylmethanamine. InChIKey: CUGXLVXNFZFUFF-ZDUSSCGKSA-N.
| Molecular formula | C13H12BrN |
|---|---|
| Molecular weight | 262.14 g/mol |
| IUPAC name | (S)-(4-bromophenyl)-phenylmethanamine |
| InChIKey | CUGXLVXNFZFUFF-ZDUSSCGKSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)