CAS 2138221-47-1 is the registry number for 7-Fluoro-2-(1-methyl-1H-pyrazol-5-yl)quinolin-4-amine, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 50mg.
7-fluoro-2-(2-methylpyrazol-3-yl)quinolin-4-amine (CAS 2138221-47-1) is a chemical compound with the molecular formula C13H11FN4 and a molecular weight of 242.25 g/mol. IUPAC name: 7-fluoro-2-(2-methylpyrazol-3-yl)quinolin-4-amine. InChIKey: GJABLOJEEVZAAO-UHFFFAOYSA-N.
| Molecular formula | C13H11FN4 |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 7-fluoro-2-(2-methylpyrazol-3-yl)quinolin-4-amine |
| InChIKey | GJABLOJEEVZAAO-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=NC3=C(C=CC(=C3)F)C(=C2)N |
Computed by PubChem (NCBI)