CAS 685106-57-4 is the registry number for 3-(4-Fluorophenyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(4-fluorophenyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine (CAS 685106-57-4) is a chemical compound with the molecular formula C13H11FN4 and a molecular weight of 242.25 g/mol. IUPAC name: 3-(4-fluorophenyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine. InChIKey: QBSKANVWHNBSBU-UHFFFAOYSA-N.
| Molecular formula | C13H11FN4 |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-5-methylpyrazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | QBSKANVWHNBSBU-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=NN2C(=C1)N)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)