CAS 2138236-02-7 is the registry number for 3-(1,2-Oxazol-3-yl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(1,2-oxazol-3-yl)aniline;hydrochloride (CAS 2138236-02-7) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 3-(1,2-oxazol-3-yl)aniline;hydrochloride. InChIKey: RJOJPVBFCHKUEJ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 3-(1,2-oxazol-3-yl)aniline;hydrochloride |
| InChIKey | RJOJPVBFCHKUEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NOC=C2.Cl |
Computed by PubChem (NCBI)