Products 2138278-86-9
CAS 2138278-86-9 is the registry number for rac-(1R,3S)-3-((5-Methylpyridin-2-yl)amino)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1S,3R)-3-[(5-methyl-2-pyridinyl)amino]cyclohexane-1-carboxylic acid (CAS 2138278-86-9) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: cis-(1S,3R)-3-[(5-methyl-2-pyridinyl)amino]cyclohexane-1-carboxylic acid. InChIKey: GNNGXKMWFKSETA-WDEREUQCSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | cis-(1S,3R)-3-[(5-methyl-2-pyridinyl)amino]cyclohexane-1-carboxylic acid |
| InChIKey | GNNGXKMWFKSETA-WDEREUQCSA-N |
| SMILES | CC1=CN=C(C=C1)N[C@@H]2CCC[C@@H](C2)C(=O)O |
Computed by PubChem (NCBI)