CAS 2138287-73-5 appears in our catalog under these names: 4-(tert-Butoxycarbonyl)thiomorpholine-2-carboxylic acid 1,1-dioxide, 98%, 2,​4-​Thiomorpholinedicarb​oxylic acid 4-​(1,​1-​dimethylethyl) ester 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazinane-2-carboxylic acid (CAS 2138287-73-5) is a chemical compound with the molecular formula C10H17NO6S and a molecular weight of 279.31 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazinane-2-carboxylic acid. InChIKey: JSBDWNFERAZSIZ-UHFFFAOYSA-N.
| Molecular formula | C10H17NO6S |
|---|---|
| Molecular weight | 279.31 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-1,1-dioxo-1,4-thiazinane-2-carboxylic acid |
| InChIKey | JSBDWNFERAZSIZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCS(=O)(=O)C(C1)C(=O)O |
Computed by PubChem (NCBI)