CAS 2279127-15-8 is the registry number for 2-((tert-Butoxycarbonyl)amino)-2-(thietan-3-yl)acetic acid 1,1-dioxide, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-(1,1-dioxothietan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 2279127-15-8) is a chemical compound with the molecular formula C10H17NO6S and a molecular weight of 279.31 g/mol. IUPAC name: 2-(1,1-dioxothietan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZESHDPYTLLIPHF-UHFFFAOYSA-N.
| Molecular formula | C10H17NO6S |
|---|---|
| Molecular weight | 279.31 g/mol |
| IUPAC name | 2-(1,1-dioxothietan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZESHDPYTLLIPHF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1CS(=O)(=O)C1)C(=O)O |
Computed by PubChem (NCBI)