Products 2138352-04-0

CAS 2138352-04-0 is the registry number for Methyl 2-(4-fluoro-2-methylphenyl)-2-propoxyacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-(4-fluoro-2-methylphenyl)-2-propoxyacetate (CAS 2138352-04-0) is a chemical compound with the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. IUPAC name: methyl 2-(4-fluoro-2-methylphenyl)-2-propoxyacetate. InChIKey: ITNVKTOSLYOCJR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17FO3
Molecular weight240.27 g/mol
IUPAC namemethyl 2-(4-fluoro-2-methylphenyl)-2-propoxyacetate
InChIKeyITNVKTOSLYOCJR-UHFFFAOYSA-N
SMILESCCCOC(C1=C(C=C(C=C1)F)C)C(=O)OC

Computed by PubChem (NCBI)