CAS 2568331-34-8 is the registry number for 4-(1,1-Dimethylethyl)-2-fluoro-5-methoxybenzeneacetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-tert-butyl-2-fluoro-5-methoxyphenyl)acetic acid (CAS 2568331-34-8) is a chemical compound with the molecular formula C13H17FO3 and a molecular weight of 240.27 g/mol. IUPAC name: 2-(4-tert-butyl-2-fluoro-5-methoxyphenyl)acetic acid. InChIKey: QDTOAABWIZXYGH-UHFFFAOYSA-N.
| Molecular formula | C13H17FO3 |
|---|---|
| Molecular weight | 240.27 g/mol |
| IUPAC name | 2-(4-tert-butyl-2-fluoro-5-methoxyphenyl)acetic acid |
| InChIKey | QDTOAABWIZXYGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C(=C1)F)CC(=O)O)OC |
Computed by PubChem (NCBI)