Products 2138428-91-6
CAS 2138428-91-6 is the registry number for Ethyl 1-benzyl-5-(2,5-dimethylphenyl)-1H-pyrazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 1-benzyl-5-(2,5-dimethylphenyl)pyrazole-4-carboxylate (CAS 2138428-91-6) is a chemical compound with the molecular formula C21H22N2O2 and a molecular weight of 334.4 g/mol. IUPAC name: ethyl 1-benzyl-5-(2,5-dimethylphenyl)pyrazole-4-carboxylate. InChIKey: ZBWDZVPSRMZDBA-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | ethyl 1-benzyl-5-(2,5-dimethylphenyl)pyrazole-4-carboxylate |
| InChIKey | ZBWDZVPSRMZDBA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)CC2=CC=CC=C2)C3=C(C=CC(=C3)C)C |
Computed by PubChem (NCBI)