CAS 2138490-93-2 is the registry number for 2-(6-Chlorodibenzo[b,d]furan-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 25g.
2-(6-chlorodibenzofuran-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2138490-93-2) is a chemical compound with the molecular formula C18H18BClO3 and a molecular weight of 328.6 g/mol. IUPAC name: 2-(6-chlorodibenzofuran-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OZGVBFCOUOGRLB-UHFFFAOYSA-N.
| Molecular formula | C18H18BClO3 |
|---|---|
| Molecular weight | 328.6 g/mol |
| IUPAC name | 2-(6-chlorodibenzofuran-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OZGVBFCOUOGRLB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C4=C(C(=CC=C4)Cl)OC3=CC=C2 |
Computed by PubChem (NCBI)