CAS 2404594-48-3 is the registry number for 3-Chloro-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(3-chlorodibenzofuran-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2404594-48-3) is a chemical compound with the molecular formula C18H18BClO3 and a molecular weight of 328.6 g/mol. IUPAC name: 2-(3-chlorodibenzofuran-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: TXOOMABZJMJEBS-UHFFFAOYSA-N.
| Molecular formula | C18H18BClO3 |
|---|---|
| Molecular weight | 328.6 g/mol |
| IUPAC name | 2-(3-chlorodibenzofuran-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | TXOOMABZJMJEBS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2C4=CC=CC=C4O3)Cl |
Computed by PubChem (NCBI)