CAS 2138573-46-1 is the registry number for 2-{((tert-butoxy)carbonyl)amino}pyridine-4-sulfinate lithium (I). Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-sulfinate (CAS 2138573-46-1) is a chemical compound with the molecular formula C10H13LiN2O4S and a molecular weight of 264.3 g/mol. IUPAC name: lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-sulfinate. InChIKey: PRXFLLOHQZJFEL-UHFFFAOYSA-M.
| Molecular formula | C10H13LiN2O4S |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-4-sulfinate |
| InChIKey | PRXFLLOHQZJFEL-UHFFFAOYSA-M |
| SMILES | [Li+].CC(C)(C)OC(=O)NC1=NC=CC(=C1)S(=O)[O-] |
Computed by PubChem (NCBI)