CAS 2172496-82-9 is the registry number for 5-{((tert-butoxy)carbonyl)amino}pyridine-2-sulfinate lithium. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-sulfinate (CAS 2172496-82-9) is a chemical compound with the molecular formula C10H13LiN2O4S and a molecular weight of 264.3 g/mol. IUPAC name: lithium 5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-sulfinate. InChIKey: YYIXXRWUAKJXJM-UHFFFAOYSA-M.
| Molecular formula | C10H13LiN2O4S |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | lithium 5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-sulfinate |
| InChIKey | YYIXXRWUAKJXJM-UHFFFAOYSA-M |
| SMILES | [Li+].CC(C)(C)OC(=O)NC1=CN=C(C=C1)S(=O)[O-] |
Computed by PubChem (NCBI)