Products 21386-95-8
CAS 21386-95-8 is the registry number for Metoclopramide Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-5-chloro-2-hydroxybenzoic acid (CAS 21386-95-8) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 4-amino-5-chloro-2-hydroxybenzoic acid. InChIKey: YDPNBRVAZXOPLH-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 4-amino-5-chloro-2-hydroxybenzoic acid |
| InChIKey | YDPNBRVAZXOPLH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)N)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Amino-5-chloro-2-hydroxybenzoic acid, Benzoic acid, 4-amino-5-chloro-2-hydroxy-, 4-amino-5-chloro-2-hydroxy-benzoic acid, 4-amino-5-chlorosalicylic acid, YDPNBRVAZXOPLH-UHFFFAOYSA-N, Salicylic acid, 4-amino-5-chloro-, 2-Hydroxy-4-amino-5-chlorobenzoic acid, Benzoicacid,4-amino-5-chloro-2-hydroxy-