CAS 2139228-56-9 is the registry number for Rel-(1R,3r,5S,6r)-3-((tert-butyldimethylsilyl)oxy)bicyclo[3.1.0]hexan-6-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,5S)-3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.1.0]hexan-6-amine (CAS 2139228-56-9) is a chemical compound with the molecular formula C12H25NOSi and a molecular weight of 227.42 g/mol. IUPAC name: (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.1.0]hexan-6-amine. InChIKey: LITROSQEWIXCCG-GGWWSXTCSA-N.
| Molecular formula | C12H25NOSi |
|---|---|
| Molecular weight | 227.42 g/mol |
| IUPAC name | (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxybicyclo[3.1.0]hexan-6-amine |
| InChIKey | LITROSQEWIXCCG-GGWWSXTCSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@@H]2[C@H](C1)C2N |
Computed by PubChem (NCBI)