CAS 225245-20-5 is the registry number for 4-(tert-Butyl-dimethyl-silanyloxy)-3,3-dimethyl-butyronitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanenitrile (CAS 225245-20-5) is a chemical compound with the molecular formula C12H25NOSi and a molecular weight of 227.42 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanenitrile. InChIKey: BUJNXPSXOMGZFG-UHFFFAOYSA-N.
| Molecular formula | C12H25NOSi |
|---|---|
| Molecular weight | 227.42 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanenitrile |
| InChIKey | BUJNXPSXOMGZFG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(C)(C)CC#N |
Computed by PubChem (NCBI)