Products 21409-25-6
CAS 21409-25-6 appears in our catalog under these names: Diphenhydramine Impurity 1, Diphenhydramine Impurity 10, 2-(Benzhydryloxy)acetic acid, 95+%, 2-(Diphenylmethoxy)acetic acid. Offered by: Chemat Brand, AmBeed, Biosynth. Available pack sizes: on request, 5g, 2,5g, 250mg.
2-benzhydryloxyacetic acid (CAS 21409-25-6) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-benzhydryloxyacetic acid. InChIKey: KWGQOJWITMQEOT-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-benzhydryloxyacetic acid |
| InChIKey | KWGQOJWITMQEOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(diphenylmethoxy)acetic acid, BENZHYDRYLOXYACETIC ACID, Acetic acid, (diphenylmethoxy)-, (Benzhydryloxy)acetic acid, 2-(benzhydryloxy)acetic acid, 2-benzhydryloxyacetic acid, Diphenylmethoxy acetic acid, 2-(benzhydryloxy)aceticacid, (Benzhydryloxy)acetic acid #, (diphenylmethoxy) acetic acid