CAS 2142574-09-0 is the registry number for Venetoclax Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid (CAS 2142574-09-0) is a chemical compound with the molecular formula C14H9FN2O3 and a molecular weight of 272.23 g/mol. IUPAC name: 4-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid. InChIKey: ZMOOAUMAIIEUIP-UHFFFAOYSA-N.
| Molecular formula | C14H9FN2O3 |
|---|---|
| Molecular weight | 272.23 g/mol |
| IUPAC name | 4-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoic acid |
| InChIKey | ZMOOAUMAIIEUIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)OC2=CN=C3C(=C2)C=CN3)C(=O)O |
Computed by PubChem (NCBI)