CAS 750599-07-6 is the registry number for 5-(5-Fluoro-2-hydroxybenzoyl)-1-methyl-2-oxo-1,2-dihydropyridine-3-carbonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-(5-fluoro-2-hydroxybenzoyl)-1-methyl-2-oxopyridine-3-carbonitrile (CAS 750599-07-6) is a chemical compound with the molecular formula C14H9FN2O3 and a molecular weight of 272.23 g/mol. IUPAC name: 5-(5-fluoro-2-hydroxybenzoyl)-1-methyl-2-oxopyridine-3-carbonitrile. InChIKey: SGTSCHIAZHARNC-UHFFFAOYSA-N.
| Molecular formula | C14H9FN2O3 |
|---|---|
| Molecular weight | 272.23 g/mol |
| IUPAC name | 5-(5-fluoro-2-hydroxybenzoyl)-1-methyl-2-oxopyridine-3-carbonitrile |
| InChIKey | SGTSCHIAZHARNC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C(C1=O)C#N)C(=O)C2=C(C=CC(=C2)F)O |
Computed by PubChem (NCBI)