Products 2142633-98-3
CAS 2142633-98-3 is the registry number for tert-Butyl (R)-(1-(1H-indazol-4-yl)propan-2-yl)carbamate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(2R)-1-(1H-indazol-4-yl)propan-2-yl]carbamate (CAS 2142633-98-3) is a chemical compound with the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. IUPAC name: tert-butyl N-[(2R)-1-(1H-indazol-4-yl)propan-2-yl]carbamate. InChIKey: ZGGACVXELDNHJG-SNVBAGLBSA-N.
| Molecular formula | C15H21N3O2 |
|---|---|
| Molecular weight | 275.35 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-(1H-indazol-4-yl)propan-2-yl]carbamate |
| InChIKey | ZGGACVXELDNHJG-SNVBAGLBSA-N |
| SMILES | C[C@H](CC1=C2C=NNC2=CC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)