Products 2143072-85-7
CAS 2143072-85-7 appears in our catalog under these names: RAGE 229, RAGE 229, RAGE 229, 99%, 99%, RAGE 229, 99.89%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 25mg, 50mg, 100mg, 1mg, 10mg, 10mM/1mL.
N-[4-[7-cyano-4-(morpholin-4-ylmethyl)quinolin-2-yl]phenyl]acetamide (CAS 2143072-85-7) is a chemical compound with the molecular formula C23H22N4O2 and a molecular weight of 386.4 g/mol. IUPAC name: N-[4-[7-cyano-4-(morpholin-4-ylmethyl)quinolin-2-yl]phenyl]acetamide. InChIKey: VDYYVNHJRNDKDO-UHFFFAOYSA-N.
| Molecular formula | C23H22N4O2 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | N-[4-[7-cyano-4-(morpholin-4-ylmethyl)quinolin-2-yl]phenyl]acetamide |
| InChIKey | VDYYVNHJRNDKDO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C2=NC3=C(C=CC(=C3)C#N)C(=C2)CN4CCOCC4 |
Computed by PubChem (NCBI)