CAS 875638-86-1 is the registry number for HPK1-IN-61. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-amino-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide (CAS 875638-86-1) is a chemical compound with the molecular formula C23H22N4O2 and a molecular weight of 386.4 g/mol. IUPAC name: 2-amino-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide. InChIKey: WXWRMODVCNBNEA-UHFFFAOYSA-N.
| Molecular formula | C23H22N4O2 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 2-amino-5-[3-(2-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide |
| InChIKey | WXWRMODVCNBNEA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)C2=CC3=C(NC=C3C4=CC=CC=C4OC)N=C2)N |
Computed by PubChem (NCBI)