CAS 21431-13-0 appears in our catalog under these names: 2-Methyl-1,3-benzothiazole-6-sulfonyl chloride, 95%, 2-Methylbenzo(d)thiazole-6-sulfonyl chloride, 97%, 2-Methyl-benzothiazole-6-sulfonyl chloride, 2-Methyl-1,3-benzothiazole-6-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 0,5g, 100mg.
2-methyl-1,3-benzothiazole-6-sulfonyl chloride (CAS 21431-13-0) is a chemical compound with the molecular formula C8H6ClNO2S2 and a molecular weight of 247.7 g/mol. IUPAC name: 2-methyl-1,3-benzothiazole-6-sulfonyl chloride. InChIKey: PMMBRDLKYRRHMI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S2 |
|---|---|
| Molecular weight | 247.7 g/mol |
| IUPAC name | 2-methyl-1,3-benzothiazole-6-sulfonyl chloride |
| InChIKey | PMMBRDLKYRRHMI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)