Products 5036-85-1

CAS 5036-85-1 is the registry number for 2-Methylbenzo[d]thiazole-4-sulfonyl chloride, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-methyl-1,3-benzothiazole-4-sulfonyl chloride (CAS 5036-85-1) is a chemical compound with the molecular formula C8H6ClNO2S2 and a molecular weight of 247.7 g/mol. IUPAC name: 2-methyl-1,3-benzothiazole-4-sulfonyl chloride. InChIKey: VLWQNWSNCAAZHW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClNO2S2
Molecular weight247.7 g/mol
IUPAC name2-methyl-1,3-benzothiazole-4-sulfonyl chloride
InChIKeyVLWQNWSNCAAZHW-UHFFFAOYSA-N
SMILESCC1=NC2=C(S1)C=CC=C2S(=O)(=O)Cl

Computed by PubChem (NCBI)