CAS 5036-85-1 is the registry number for 2-Methylbenzo[d]thiazole-4-sulfonyl chloride, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 250mg, 1g.
2-methyl-1,3-benzothiazole-4-sulfonyl chloride (CAS 5036-85-1) is a chemical compound with the molecular formula C8H6ClNO2S2 and a molecular weight of 247.7 g/mol. IUPAC name: 2-methyl-1,3-benzothiazole-4-sulfonyl chloride. InChIKey: VLWQNWSNCAAZHW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S2 |
|---|---|
| Molecular weight | 247.7 g/mol |
| IUPAC name | 2-methyl-1,3-benzothiazole-4-sulfonyl chloride |
| InChIKey | VLWQNWSNCAAZHW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)