CAS 214337-39-0 is the registry number for 2-Bromo-5-methoxybenzothiazole, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
2-bromo-5-methoxy-1,3-benzothiazole (CAS 214337-39-0) is a chemical compound with the molecular formula C8H6BrNOS and a molecular weight of 244.11 g/mol. IUPAC name: 2-bromo-5-methoxy-1,3-benzothiazole. InChIKey: XDYFAYVQPCTFOY-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNOS |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 2-bromo-5-methoxy-1,3-benzothiazole |
| InChIKey | XDYFAYVQPCTFOY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)SC(=N2)Br |
Computed by PubChem (NCBI)