Products 2143956-76-5
CAS 2143956-76-5 is the registry number for tert-Butyl (2R,5R)-5-(hydroxymethyl)-2-methylpiperazine-1-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,5R)-5-(hydroxymethyl)-2-methylpiperazine-1-carboxylate;hydrochloride (CAS 2143956-76-5) is a chemical compound with the molecular formula C11H23ClN2O3 and a molecular weight of 266.76 g/mol. IUPAC name: tert-butyl (2R,5R)-5-(hydroxymethyl)-2-methylpiperazine-1-carboxylate;hydrochloride. InChIKey: XPEUNBWSGPAPNE-VTLYIQCISA-N.
| Molecular formula | C11H23ClN2O3 |
|---|---|
| Molecular weight | 266.76 g/mol |
| IUPAC name | tert-butyl (2R,5R)-5-(hydroxymethyl)-2-methylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | XPEUNBWSGPAPNE-VTLYIQCISA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C(=O)OC(C)(C)C)CO.Cl |
Computed by PubChem (NCBI)