CAS 95977-55-2 appears in our catalog under these names: H–Val–Leu–OH · HCl, H-Val-Leu-OH·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 25g, 5g, 10g, 50g.
(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoic acid;hydrochloride (CAS 95977-55-2) is a chemical compound with the molecular formula C11H23ClN2O3 and a molecular weight of 266.76 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoic acid;hydrochloride. InChIKey: DTHPWDPDAJVHPD-OZZZDHQUSA-N.
| Molecular formula | C11H23ClN2O3 |
|---|---|
| Molecular weight | 266.76 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylpentanoic acid;hydrochloride |
| InChIKey | DTHPWDPDAJVHPD-OZZZDHQUSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)N.Cl |
Computed by PubChem (NCBI)