CAS 2260932-52-1 is the registry number for tert-Butyl 3-(1-aminoethyl)-3-hydroxypyrrolidine-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-(1-aminoethyl)-3-hydroxypyrrolidine-1-carboxylate;hydrochloride (CAS 2260932-52-1) is a chemical compound with the molecular formula C11H23ClN2O3 and a molecular weight of 266.76 g/mol. IUPAC name: tert-butyl 3-(1-aminoethyl)-3-hydroxypyrrolidine-1-carboxylate;hydrochloride. InChIKey: NHNOBRLVRSFMPJ-UHFFFAOYSA-N.
| Molecular formula | C11H23ClN2O3 |
|---|---|
| Molecular weight | 266.76 g/mol |
| IUPAC name | tert-butyl 3-(1-aminoethyl)-3-hydroxypyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | NHNOBRLVRSFMPJ-UHFFFAOYSA-N |
| SMILES | CC(C1(CCN(C1)C(=O)OC(C)(C)C)O)N.Cl |
Computed by PubChem (NCBI)