Products 214479-33-1
CAS 214479-33-1 is the registry number for ONO-1714. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,5S,6R,7R)-7-chloro-5-methyl-2-azabicyclo[4.1.0]hept-2-en-3-amine;hydrochloride (CAS 214479-33-1) is a chemical compound with the molecular formula C7H12Cl2N2 and a molecular weight of 195.09 g/mol. IUPAC name: (1S,5S,6R,7R)-7-chloro-5-methyl-2-azabicyclo[4.1.0]hept-2-en-3-amine;hydrochloride. InChIKey: IZIZKGZAEABSET-IEUZAGAGSA-N.
| Molecular formula | C7H12Cl2N2 |
|---|---|
| Molecular weight | 195.09 g/mol |
| IUPAC name | (1S,5S,6R,7R)-7-chloro-5-methyl-2-azabicyclo[4.1.0]hept-2-en-3-amine;hydrochloride |
| InChIKey | IZIZKGZAEABSET-IEUZAGAGSA-N |
| SMILES | C[C@H]1CC(=N[C@H]2[C@@H]1[C@H]2Cl)N.Cl |
Computed by PubChem (NCBI)