Products 2144793-11-1
CAS 2144793-11-1 is the registry number for But-3-yn-1-yl (2S)-2-amino-3-methylbutanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
But-3-ynyl (2S)-2-amino-3-methylbutanoate (CAS 2144793-11-1) is a chemical compound with the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. IUPAC name: but-3-ynyl (2S)-2-amino-3-methylbutanoate. InChIKey: LZYWAFFTPKZNCO-QMMMGPOBSA-N.
| Molecular formula | C9H15NO2 |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | but-3-ynyl (2S)-2-amino-3-methylbutanoate |
| InChIKey | LZYWAFFTPKZNCO-QMMMGPOBSA-N |
| SMILES | CC(C)[C@@H](C(=O)OCCC#C)N |
Computed by PubChem (NCBI)