Products 2146096-02-6
CAS 2146096-02-6 is the registry number for 2-(3-(But-3-yn-1-yl)-3H-diazirin-3-yl)ethyl 4-methylbenzenesulfonate, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(3-but-3-ynyldiazirin-3-yl)ethyl 4-methylbenzenesulfonate (CAS 2146096-02-6) is a chemical compound with the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. IUPAC name: 2-(3-but-3-ynyldiazirin-3-yl)ethyl 4-methylbenzenesulfonate. InChIKey: UCYSTTRNCSIVDT-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3S |
|---|---|
| Molecular weight | 292.36 g/mol |
| IUPAC name | 2-(3-but-3-ynyldiazirin-3-yl)ethyl 4-methylbenzenesulfonate |
| InChIKey | UCYSTTRNCSIVDT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCC2(N=N2)CCC#C |
Computed by PubChem (NCBI)