CAS 436091-90-6 is the registry number for 4-Amino-n-(4-methoxybenzyl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-amino-N-[(4-methoxyphenyl)methyl]benzenesulfonamide (CAS 436091-90-6) is a chemical compound with the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. IUPAC name: 4-amino-N-[(4-methoxyphenyl)methyl]benzenesulfonamide. InChIKey: RSKLWIXTGFLDDB-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3S |
|---|---|
| Molecular weight | 292.36 g/mol |
| IUPAC name | 4-amino-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
| InChIKey | RSKLWIXTGFLDDB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)