CAS 214629-34-2 is the registry number for tert-Butyl ((3S,4R)-4-hydroxypyrrolidin-3-yl)carbamate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Tert-butyl N-[(3S,4R)-4-hydroxypyrrolidin-3-yl]carbamate (CAS 214629-34-2) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl N-[(3S,4R)-4-hydroxypyrrolidin-3-yl]carbamate. InChIKey: QAZVTJCOYJOJGO-NKWVEPMBSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl N-[(3S,4R)-4-hydroxypyrrolidin-3-yl]carbamate |
| InChIKey | QAZVTJCOYJOJGO-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNC[C@H]1O |
Computed by PubChem (NCBI)