CAS 21467-17-4 appears in our catalog under these names: (S)–5–Amino–2–((S)–2–(((benzyloxy)carbonyl)amino)propanamido)–5–oxopentanoic acid, Cbz-Ala-Gln-OH 97%, Z-ALA-GLN-OH, 97%, 97%, Z-L-alanyl-L-glutamine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 1g, 5g.
(2S)-5-amino-5-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid (CAS 21467-17-4) is a chemical compound with the molecular formula C16H21N3O6 and a molecular weight of 351.35 g/mol. IUPAC name: (2S)-5-amino-5-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid. InChIKey: HJZNKZNHXJQTEU-JQWIXIFHSA-N.
| Molecular formula | C16H21N3O6 |
|---|---|
| Molecular weight | 351.35 g/mol |
| IUPAC name | (2S)-5-amino-5-oxo-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoic acid |
| InChIKey | HJZNKZNHXJQTEU-JQWIXIFHSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)