CAS 870703-72-3 appears in our catalog under these names: 4-(Boc-piperazin-1-yl)-3-nitrobenzoic acid, 95%, 1-(1,1-Dimethylethyl) 4-(4-carboxy-2-nitrophenyl)-1-piperazinecarboxylate. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg.
4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-nitrobenzoic acid (CAS 870703-72-3) is a chemical compound with the molecular formula C16H21N3O6 and a molecular weight of 351.35 g/mol. IUPAC name: 4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-nitrobenzoic acid. InChIKey: CYGRJUZYSXUAMM-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O6 |
|---|---|
| Molecular weight | 351.35 g/mol |
| IUPAC name | 4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-nitrobenzoic acid |
| InChIKey | CYGRJUZYSXUAMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)