CAS 214683-09-7 is the registry number for 2,4,7-Trimethyl-1-benzofuran-5-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4,7-trimethyl-1-benzofuran-5-amine (CAS 214683-09-7) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 2,4,7-trimethyl-1-benzofuran-5-amine. InChIKey: WEOHFJYVKSFDRN-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2,4,7-trimethyl-1-benzofuran-5-amine |
| InChIKey | WEOHFJYVKSFDRN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1OC(=C2)C)C)N |
Computed by PubChem (NCBI)