Products 214698-03-0
CAS 214698-03-0 appears in our catalog under these names: 7-Amino-1,2,3,4-tetrahydronaphthol, 97%, 7–Amino–1，2，3，4–tetrahydronaphthol, 7-Amino-1,2,3,4-tetrahydronaphthol, 7-Amino-1,2,3,4-tetrahydronaphthalen-1-ol 97%, 7-Amino-1,2,3,4-tetrahydronaphthalen-1-ol, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 2,5g, 100mg, 250mg.
7-amino-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 214698-03-0) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: 7-amino-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: NUDRGEJVHRQBJZ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | 7-amino-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | NUDRGEJVHRQBJZ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC(=C2)N)O |
Computed by PubChem (NCBI)