CAS 214750-67-1 is the registry number for Boc-L-Dap(Dnp)-OH. Offered by: Iris Biotech. Available pack sizes: 1g.
(2S)-3-(2,4-dinitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 214750-67-1) is a chemical compound with the molecular formula C14H18N4O8 and a molecular weight of 370.31 g/mol. IUPAC name: (2S)-3-(2,4-dinitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: XKHQTCSLBRZQAC-JTQLQIEISA-N.
| Molecular formula | C14H18N4O8 |
|---|---|
| Molecular weight | 370.31 g/mol |
| IUPAC name | (2S)-3-(2,4-dinitroanilino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | XKHQTCSLBRZQAC-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)