CAS 214847-64-0 appears in our catalog under these names: 3-Isopropoxybenzoyl chloride, 95%, 3-Isopropoxybenzoyl chloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 500mg, 2000mg, 1000mg.
3-propan-2-yloxybenzoyl chloride (CAS 214847-64-0) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 3-propan-2-yloxybenzoyl chloride. InChIKey: WPIMBZGVPVKFDT-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 3-propan-2-yloxybenzoyl chloride |
| InChIKey | WPIMBZGVPVKFDT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=CC(=C1)C(=O)Cl |
Computed by PubChem (NCBI)