CAS 214957-88-7 is the registry number for 2-{((Benzyloxy)carbonyl)amino}-5-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-hydroxy-2-(phenylmethoxycarbonylamino)benzoic acid (CAS 214957-88-7) is a chemical compound with the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. IUPAC name: 5-hydroxy-2-(phenylmethoxycarbonylamino)benzoic acid. InChIKey: JABAHAYGUIMUBF-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 5-hydroxy-2-(phenylmethoxycarbonylamino)benzoic acid |
| InChIKey | JABAHAYGUIMUBF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=C(C=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)