Products 214957-88-7

CAS 214957-88-7 is the registry number for 2-{((Benzyloxy)carbonyl)amino}-5-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-hydroxy-2-(phenylmethoxycarbonylamino)benzoic acid (CAS 214957-88-7) is a chemical compound with the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. IUPAC name: 5-hydroxy-2-(phenylmethoxycarbonylamino)benzoic acid. InChIKey: JABAHAYGUIMUBF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13NO5
Molecular weight287.27 g/mol
IUPAC name5-hydroxy-2-(phenylmethoxycarbonylamino)benzoic acid
InChIKeyJABAHAYGUIMUBF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NC2=C(C=C(C=C2)O)C(=O)O

Computed by PubChem (NCBI)