CAS 2149601-44-3 is the registry number for 3,5-Difluoro-4-iodobenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,3-difluoro-2-iodo-5-(trifluoromethyl)benzene (CAS 2149601-44-3) is a chemical compound with the molecular formula C7H2F5I and a molecular weight of 307.99 g/mol. IUPAC name: 1,3-difluoro-2-iodo-5-(trifluoromethyl)benzene. InChIKey: LXWJUDSCZDEINE-UHFFFAOYSA-N.
| Molecular formula | C7H2F5I |
|---|---|
| Molecular weight | 307.99 g/mol |
| IUPAC name | 1,3-difluoro-2-iodo-5-(trifluoromethyl)benzene |
| InChIKey | LXWJUDSCZDEINE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)I)F)C(F)(F)F |
Computed by PubChem (NCBI)