CAS 910787-71-2 is the registry number for 2,6-Difluoro-4-iodobenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1,3-difluoro-5-iodo-2-(trifluoromethyl)benzene (CAS 910787-71-2) is a chemical compound with the molecular formula C7H2F5I and a molecular weight of 307.99 g/mol. IUPAC name: 1,3-difluoro-5-iodo-2-(trifluoromethyl)benzene. InChIKey: PFVGWSZEDWYASA-UHFFFAOYSA-N.
| Molecular formula | C7H2F5I |
|---|---|
| Molecular weight | 307.99 g/mol |
| IUPAC name | 1,3-difluoro-5-iodo-2-(trifluoromethyl)benzene |
| InChIKey | PFVGWSZEDWYASA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(F)(F)F)F)I |
Computed by PubChem (NCBI)