CAS 21505-06-6 is the registry number for N5-Benzyl-1h-1,2,4-triazole-3,5-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-N-benzyl-1H-1,2,4-triazole-3,5-diamine (CAS 21505-06-6) is a chemical compound with the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. IUPAC name: 3-N-benzyl-1H-1,2,4-triazole-3,5-diamine. InChIKey: STKMUWKEILTMII-UHFFFAOYSA-N.
| Molecular formula | C9H11N5 |
|---|---|
| Molecular weight | 189.22 g/mol |
| IUPAC name | 3-N-benzyl-1H-1,2,4-triazole-3,5-diamine |
| InChIKey | STKMUWKEILTMII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NNC(=N2)N |
Computed by PubChem (NCBI)